C14H17ClO — CID 62504262
1-(3-chlorophenyl)-3-cyclopentylpropan-2-one (PubChem CID 62504262) has the molecular formula C14H17ClO and a molecular weight of 236.74 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-cyclopentylpropan-2-one.
| Compound Name | 1-(3-chlorophenyl)-3-cyclopentylpropan-2-one |
|---|---|
| PubChem CID | 62504262 |
| Molecular Formula | C14H17ClO |
| Molecular Weight | 236.74 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 1-(3-chlorophenyl)-3-cyclopentylpropan-2-one |
| SMILES | O=C(Cc1cccc(Cl)c1)CC1CCCC1 |
| InChI | InChI=1S/C14H17ClO/c15-13-7-3-6-12(8-13)10-14(16)9-11-4-1-2-5-11/h3,6-8,11H,1-2,4-5,9-10H2 |
| InChIKey | GTJCGMMKXAQJQL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.74 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |