C19H29ClN2O — CID 170579151
1-chloro-3-(cyclopentylmethyl)benzene;cyclohexylurea (PubChem CID 170579151) has the molecular formula C19H29ClN2O and a molecular weight of 336.91 g/mol. Its IUPAC name is 1-chloro-3-(cyclopentylmethyl)benzene;cyclohexylurea.
| Compound Name | 1-chloro-3-(cyclopentylmethyl)benzene;cyclohexylurea |
|---|---|
| PubChem CID | 170579151 |
| Molecular Formula | C19H29ClN2O |
| Molecular Weight | 336.91 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 1-chloro-3-(cyclopentylmethyl)benzene;cyclohexylurea |
| SMILES | Clc1cccc(CC2CCCC2)c1.NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C12H15Cl.C7H14N2O/c13-12-7-3-6-11(9-12)8-10-4-1-2-5-10;8-7(10)9-6-4-2-1-3-5-6/h3,6-7,9-10H,1-2,4-5,8H2;6H,1-5H2,(H3,8,9,10) |
| InChIKey | UCODQXUWJQVIOZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.91 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |