C25H28O3 — CID 145487823
1-cyclopentyl-3-[3-[2-oxo-2-[4-(2-oxopropyl)phenyl]ethyl]phenyl]propan-2-one (PubChem CID 145487823) has the molecular formula C25H28O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is 1-cyclopentyl-3-[3-[2-oxo-2-[4-(2-oxopropyl)phenyl]ethyl]phenyl]propan-2-one.
| Compound Name | 1-cyclopentyl-3-[3-[2-oxo-2-[4-(2-oxopropyl)phenyl]ethyl]phenyl]propan-2-one |
|---|---|
| PubChem CID | 145487823 |
| Molecular Formula | C25H28O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 1-cyclopentyl-3-[3-[2-oxo-2-[4-(2-oxopropyl)phenyl]ethyl]phenyl]propan-2-one |
| SMILES | CC(=O)Cc1ccc(C(=O)Cc2cccc(CC(=O)CC3CCCC3)c2)cc1 |
| InChI | InChI=1S/C25H28O3/c1-18(26)13-20-9-11-23(12-10-20)25(28)17-22-8-4-7-21(14-22)16-24(27)15-19-5-2-3-6-19/h4,7-12,14,19H,2-3,5-6,13,15-17H2,1H3 |
| InChIKey | VFLKQHBGDYHIQO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |