C21H25ClFNO — CID 160688271
1-(4-fluorophenyl)-2-[3-[(1-methylpiperidin-4-yl)methyl]phenyl]ethanone;hydrochloride (PubChem CID 160688271) has the molecular formula C21H25ClFNO and a molecular weight of 361.89 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-[3-[(1-methylpiperidin-4-yl)methyl]phenyl]ethanone;hydrochloride.
| Compound Name | 1-(4-fluorophenyl)-2-[3-[(1-methylpiperidin-4-yl)methyl]phenyl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 160688271 |
| Molecular Formula | C21H25ClFNO |
| Molecular Weight | 361.89 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 1-(4-fluorophenyl)-2-[3-[(1-methylpiperidin-4-yl)methyl]phenyl]ethanone;hydrochloride |
| SMILES | CN1CCC(Cc2cccc(CC(=O)c3ccc(F)cc3)c2)CC1.Cl |
| InChI | InChI=1S/C21H24FNO.ClH/c1-23-11-9-16(10-12-23)13-17-3-2-4-18(14-17)15-21(24)19-5-7-20(22)8-6-19;/h2-8,14,16H,9-13,15H2,1H3;1H |
| InChIKey | YVTIWDQCEZTVIJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.89 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |