C17H25FN2O — CID 63273502
1-(4-fluorophenyl)-4-[methyl-[(1-methylpyrrolidin-3-yl)methyl]amino]butan-1-one (PubChem CID 63273502) has the molecular formula C17H25FN2O and a molecular weight of 292.40 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[methyl-[(1-methylpyrrolidin-3-yl)methyl]amino]butan-1-one.
| Compound Name | 1-(4-fluorophenyl)-4-[methyl-[(1-methylpyrrolidin-3-yl)methyl]amino]butan-1-one |
|---|---|
| PubChem CID | 63273502 |
| Molecular Formula | C17H25FN2O |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[methyl-[(1-methylpyrrolidin-3-yl)methyl]amino]butan-1-one |
| SMILES | CN(CCCC(=O)c1ccc(F)cc1)CC1CCN(C)C1 |
| InChI | InChI=1S/C17H25FN2O/c1-19(12-14-9-11-20(2)13-14)10-3-4-17(21)15-5-7-16(18)8-6-15/h5-8,14H,3-4,9-13H2,1-2H3 |
| InChIKey | VGRUGDMRYNPGFH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |