C13H13BrClNO — CID 90548493
4-bromo-N-[3-(3-chlorophenyl)prop-2-ynyl]butanamide (PubChem CID 90548493) has the molecular formula C13H13BrClNO and a molecular weight of 314.61 g/mol. Its IUPAC name is 4-bromo-N-[3-(3-chlorophenyl)prop-2-ynyl]butanamide.
| Compound Name | 4-bromo-N-[3-(3-chlorophenyl)prop-2-ynyl]butanamide |
|---|---|
| PubChem CID | 90548493 |
| Molecular Formula | C13H13BrClNO |
| Molecular Weight | 314.61 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 4-bromo-N-[3-(3-chlorophenyl)prop-2-ynyl]butanamide |
| SMILES | O=C(CCCBr)NCC#Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H13BrClNO/c14-8-2-7-13(17)16-9-3-5-11-4-1-6-12(15)10-11/h1,4,6,10H,2,7-9H2,(H,16,17) |
| InChIKey | ICAWQCVHZLIVHF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.61 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|