C13H12ClNO3 — CID 90548374
ethyl 2-[3-(3-chlorophenyl)prop-2-ynylamino]-2-oxoacetate (PubChem CID 90548374) has the molecular formula C13H12ClNO3 and a molecular weight of 265.70 g/mol. Its IUPAC name is ethyl 2-[3-(3-chlorophenyl)prop-2-ynylamino]-2-oxoacetate.
| Compound Name | ethyl 2-[3-(3-chlorophenyl)prop-2-ynylamino]-2-oxoacetate |
|---|---|
| PubChem CID | 90548374 |
| Molecular Formula | C13H12ClNO3 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | ethyl 2-[3-(3-chlorophenyl)prop-2-ynylamino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)NCC#Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H12ClNO3/c1-2-18-13(17)12(16)15-8-4-6-10-5-3-7-11(14)9-10/h3,5,7,9H,2,8H2,1H3,(H,15,16) |
| InChIKey | CSFGFQBAOSEPTH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|