C15H19ClN2O — CID 97252215
(2S,3S)-2-[3-(3-chlorophenyl)prop-2-ynylamino]-3-methylpentanamide (PubChem CID 97252215) has the molecular formula C15H19ClN2O and a molecular weight of 278.78 g/mol. Its IUPAC name is (2S,3S)-2-[3-(3-chlorophenyl)prop-2-ynylamino]-3-methylpentanamide.
| Compound Name | (2S,3S)-2-[3-(3-chlorophenyl)prop-2-ynylamino]-3-methylpentanamide |
|---|---|
| PubChem CID | 97252215 |
| Molecular Formula | C15H19ClN2O |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (2S,3S)-2-[3-(3-chlorophenyl)prop-2-ynylamino]-3-methylpentanamide |
| SMILES | CC[C@H](C)[C@H](NCC#Cc1cccc(Cl)c1)C(N)=O |
| InChI | InChI=1S/C15H19ClN2O/c1-3-11(2)14(15(17)19)18-9-5-7-12-6-4-8-13(16)10-12/h4,6,8,10-11,14,18H,3,9H2,1-2H3,(H2,17,19)/t11-,14-/m0/s1 |
| InChIKey | GQNSKECLPXTRRE-FZMZJTMJSA-N |
| XLogP | 2.18 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|