C16H15ClN2O2 — CID 90548552
N-[3-(3-chlorophenyl)prop-2-ynyl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide (PubChem CID 90548552) has the molecular formula C16H15ClN2O2 and a molecular weight of 302.76 g/mol. Its IUPAC name is N-[3-(3-chlorophenyl)prop-2-ynyl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide.
| Compound Name | N-[3-(3-chlorophenyl)prop-2-ynyl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide |
|---|---|
| PubChem CID | 90548552 |
| Molecular Formula | C16H15ClN2O2 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | N-[3-(3-chlorophenyl)prop-2-ynyl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide |
| SMILES | Cc1noc(C)c1CC(=O)NCC#Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H15ClN2O2/c1-11-15(12(2)21-19-11)10-16(20)18-8-4-6-13-5-3-7-14(17)9-13/h3,5,7,9H,8,10H2,1-2H3,(H,18,20) |
| InChIKey | PTEPXXMBZJUGJL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|