C18H21N3O2 — CID 90552000
N-[3-[4-(dimethylamino)phenyl]prop-2-ynyl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide (PubChem CID 90552000) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is N-[3-[4-(dimethylamino)phenyl]prop-2-ynyl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide.
| Compound Name | N-[3-[4-(dimethylamino)phenyl]prop-2-ynyl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide |
|---|---|
| PubChem CID | 90552000 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | N-[3-[4-(dimethylamino)phenyl]prop-2-ynyl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetamide |
| SMILES | Cc1noc(C)c1CC(=O)NCC#Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C18H21N3O2/c1-13-17(14(2)23-20-13)12-18(22)19-11-5-6-15-7-9-16(10-8-15)21(3)4/h7-10H,11-12H2,1-4H3,(H,19,22) |
| InChIKey | WWPTUOANVWWLIC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|