C28H29ClN4O2 — CID 23381032
1-[[4-[3-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]prop-1-ynyl]phenyl]methyl]-1-hydroxyurea (PubChem CID 23381032) has the molecular formula C28H29ClN4O2 and a molecular weight of 489.02 g/mol. Its IUPAC name is 1-[[4-[3-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]prop-1-ynyl]phenyl]methyl]-1-hydroxyurea.
| Compound Name | 1-[[4-[3-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]prop-1-ynyl]phenyl]methyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 23381032 |
| Molecular Formula | C28H29ClN4O2 |
| Molecular Weight | 489.02 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 1-[[4-[3-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]prop-1-ynyl]phenyl]methyl]-1-hydroxyurea |
| SMILES | NC(=O)N(O)Cc1ccc(C#CCN2CCN(C(c3ccccc3)c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H29ClN4O2/c29-26-14-12-25(13-15-26)27(24-6-2-1-3-7-24)32-19-17-31(18-20-32)16-4-5-22-8-10-23(11-9-22)21-33(35)28(30)34/h1-3,6-15,27,35H,16-21H2,(H2,30,34) |
| InChIKey | JBYDZXZRAAUCGS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 73.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.02 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|