C32H36ClN3O4 — CID 59910436
ethyl N-[4-[4-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]phenyl]but-3-ynyl]-N-hydroxycarbamate (PubChem CID 59910436) has the molecular formula C32H36ClN3O4 and a molecular weight of 562.11 g/mol. Its IUPAC name is ethyl N-[4-[4-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]phenyl]but-3-ynyl]-N-hydroxycarbamate.
| Compound Name | ethyl N-[4-[4-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]phenyl]but-3-ynyl]-N-hydroxycarbamate |
|---|---|
| PubChem CID | 59910436 |
| Molecular Formula | C32H36ClN3O4 |
| Molecular Weight | 562.11 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | ethyl N-[4-[4-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]phenyl]but-3-ynyl]-N-hydroxycarbamate |
| SMILES | CCOC(=O)N(O)CCC#Cc1ccc(OCCN2CCN([C@H](c3ccccc3)c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C32H36ClN3O4/c1-2-39-32(37)36(38)19-7-6-8-26-11-17-30(18-12-26)40-25-24-34-20-22-35(23-21-34)31(27-9-4-3-5-10-27)28-13-15-29(33)16-14-28/h3-5,9-18,31,38H,2,7,19-25H2,1H3/t31-/m1/s1 |
| InChIKey | SGDMQKSRAZTFKR-WJOKGBTCSA-N |
| XLogP | 5.72 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.11 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|