C30H40N4O5 — CID 91596750
amino-[4-[4-[[4-[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]ethyl]piperazin-1-yl]-phenylmethyl]phenyl]but-3-ynyl]carbamic acid (PubChem CID 91596750) has the molecular formula C30H40N4O5 and a molecular weight of 536.67 g/mol. Its IUPAC name is amino-[4-[4-[[4-[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]ethyl]piperazin-1-yl]-phenylmethyl]phenyl]but-3-ynyl]carbamic acid.
| Compound Name | amino-[4-[4-[[4-[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]ethyl]piperazin-1-yl]-phenylmethyl]phenyl]but-3-ynyl]carbamic acid |
|---|---|
| PubChem CID | 91596750 |
| Molecular Formula | C30H40N4O5 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.30 |
| IUPAC Name | amino-[4-[4-[[4-[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]ethyl]piperazin-1-yl]-phenylmethyl]phenyl]but-3-ynyl]carbamic acid |
| SMILES | CC(C)(C)OC(=O)COCCN1CCN(C(c2ccccc2)c2ccc(C#CCCN(N)C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C30H40N4O5/c1-30(2,3)39-27(35)23-38-22-21-32-17-19-33(20-18-32)28(25-10-5-4-6-11-25)26-14-12-24(13-15-26)9-7-8-16-34(31)29(36)37/h4-6,10-15,28H,8,16-23,31H2,1-3H3,(H,36,37) |
| InChIKey | ZQVPJTUIQKDUBP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|