C29H32N4O5 — CID 70155520
amino-[4-[5-[[4-[(3-methoxycarbonylphenyl)-phenylmethyl]piperazin-1-yl]methyl]furan-2-yl]but-3-ynyl]carbamic acid (PubChem CID 70155520) has the molecular formula C29H32N4O5 and a molecular weight of 516.60 g/mol. Its IUPAC name is amino-[4-[5-[[4-[(3-methoxycarbonylphenyl)-phenylmethyl]piperazin-1-yl]methyl]furan-2-yl]but-3-ynyl]carbamic acid.
| Compound Name | amino-[4-[5-[[4-[(3-methoxycarbonylphenyl)-phenylmethyl]piperazin-1-yl]methyl]furan-2-yl]but-3-ynyl]carbamic acid |
|---|---|
| PubChem CID | 70155520 |
| Molecular Formula | C29H32N4O5 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | amino-[4-[5-[[4-[(3-methoxycarbonylphenyl)-phenylmethyl]piperazin-1-yl]methyl]furan-2-yl]but-3-ynyl]carbamic acid |
| SMILES | COC(=O)c1cccc(C(c2ccccc2)N2CCN(Cc3ccc(C#CCCN(N)C(=O)O)o3)CC2)c1 |
| InChI | InChI=1S/C29H32N4O5/c1-37-28(34)24-11-7-10-23(20-24)27(22-8-3-2-4-9-22)32-18-16-31(17-19-32)21-26-14-13-25(38-26)12-5-6-15-33(30)29(35)36/h2-4,7-11,13-14,20,27H,6,15-19,21,30H2,1H3,(H,35,36) |
| InChIKey | OYTVYTTYKPNWFZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|