C33H40ClN5O4 — CID 159325351
N-[5-[4-[carbamoyl(hydroxy)amino]but-1-ynyl]-2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]phenyl]acetamide;methane (PubChem CID 159325351) has the molecular formula C33H40ClN5O4 and a molecular weight of 606.17 g/mol. Its IUPAC name is N-[5-[4-[carbamoyl(hydroxy)amino]but-1-ynyl]-2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]phenyl]acetamide;methane.
| Compound Name | N-[5-[4-[carbamoyl(hydroxy)amino]but-1-ynyl]-2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]phenyl]acetamide;methane |
|---|---|
| PubChem CID | 159325351 |
| Molecular Formula | C33H40ClN5O4 |
| Molecular Weight | 606.17 g/mol |
| Exact Mass | 605.28 |
| IUPAC Name | N-[5-[4-[carbamoyl(hydroxy)amino]but-1-ynyl]-2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]phenyl]acetamide;methane |
| SMILES | C.CC(=O)Nc1cc(C#CCCN(O)C(N)=O)ccc1OCCN1CCN([C@H](c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C32H36ClN5O4.CH4/c1-24(39)35-29-23-25(7-5-6-16-38(41)32(34)40)10-15-30(29)42-22-21-36-17-19-37(20-18-36)31(26-8-3-2-4-9-26)27-11-13-28(33)14-12-27;/h2-4,8-15,23,31,41H,6,16-22H2,1H3,(H2,34,40)(H,35,39);1H4/t31-;/m1./s1 |
| InChIKey | LEHDVDXXCKHRPA-JSSVAETHSA-N |
| XLogP | 5.23 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.17 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|