C32H39ClN4O5 — CID 158606131
1-[4-[4-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]-3-hydroxyphenyl]but-3-ynyl]-1-hydroxyurea;formaldehyde;methane (PubChem CID 158606131) has the molecular formula C32H39ClN4O5 and a molecular weight of 595.14 g/mol. Its IUPAC name is 1-[4-[4-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]-3-hydroxyphenyl]but-3-ynyl]-1-hydroxyurea;formaldehyde;methane.
| Compound Name | 1-[4-[4-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]-3-hydroxyphenyl]but-3-ynyl]-1-hydroxyurea;formaldehyde;methane |
|---|---|
| PubChem CID | 158606131 |
| Molecular Formula | C32H39ClN4O5 |
| Molecular Weight | 595.14 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | 1-[4-[4-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]-3-hydroxyphenyl]but-3-ynyl]-1-hydroxyurea;formaldehyde;methane |
| SMILES | C.C=O.NC(=O)N(O)CCC#Cc1ccc(OCCN2CCN([C@H](c3ccccc3)c3ccc(Cl)cc3)CC2)c(O)c1 |
| InChI | InChI=1S/C30H33ClN4O4.CH2O.CH4/c31-26-12-10-25(11-13-26)29(24-7-2-1-3-8-24)34-18-16-33(17-19-34)20-21-39-28-14-9-23(22-27(28)36)6-4-5-15-35(38)30(32)37;1-2;/h1-3,7-14,22,29,36,38H,5,15-21H2,(H2,32,37);1H2;1H4/t29-;;/m1../s1 |
| InChIKey | HWGBLCZCHWMVJR-SYXKTQFYSA-N |
| XLogP | 4.79 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.14 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|