C31H37ClN4O5 — CID 59910420
5-[4-[carbamoyl(hydroxy)amino]butyl]-2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]benzoic acid (PubChem CID 59910420) has the molecular formula C31H37ClN4O5 and a molecular weight of 581.11 g/mol. Its IUPAC name is 5-[4-[carbamoyl(hydroxy)amino]butyl]-2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]benzoic acid.
| Compound Name | 5-[4-[carbamoyl(hydroxy)amino]butyl]-2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 59910420 |
| Molecular Formula | C31H37ClN4O5 |
| Molecular Weight | 581.11 g/mol |
| Exact Mass | 580.25 |
| IUPAC Name | 5-[4-[carbamoyl(hydroxy)amino]butyl]-2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]benzoic acid |
| SMILES | NC(=O)N(O)CCCCc1ccc(OCCN2CCN([C@H](c3ccccc3)c3ccc(Cl)cc3)CC2)c(C(=O)O)c1 |
| InChI | InChI=1S/C31H37ClN4O5/c32-26-12-10-25(11-13-26)29(24-7-2-1-3-8-24)35-18-16-34(17-19-35)20-21-41-28-14-9-23(22-27(28)30(37)38)6-4-5-15-36(40)31(33)39/h1-3,7-14,22,29,40H,4-6,15-21H2,(H2,33,39)(H,37,38)/t29-/m1/s1 |
| InChIKey | SIJSKZLCWBPJOM-GDLZYMKVSA-N |
| XLogP | 4.92 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.11 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|