C31H41ClN4O3 — CID 161324039
1-[3-[4-[3-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]propyl]phenoxy]propyl]-1-hydroxyurea;methane (PubChem CID 161324039) has the molecular formula C31H41ClN4O3 and a molecular weight of 553.15 g/mol. Its IUPAC name is 1-[3-[4-[3-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]propyl]phenoxy]propyl]-1-hydroxyurea;methane.
| Compound Name | 1-[3-[4-[3-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]propyl]phenoxy]propyl]-1-hydroxyurea;methane |
|---|---|
| PubChem CID | 161324039 |
| Molecular Formula | C31H41ClN4O3 |
| Molecular Weight | 553.15 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | 1-[3-[4-[3-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]propyl]phenoxy]propyl]-1-hydroxyurea;methane |
| SMILES | C.NC(=O)N(O)CCCOc1ccc(CCCN2CCN([C@H](c3ccccc3)c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C30H37ClN4O3.CH4/c31-27-13-11-26(12-14-27)29(25-7-2-1-3-8-25)34-21-19-33(20-22-34)17-4-6-24-9-15-28(16-10-24)38-23-5-18-35(37)30(32)36;/h1-3,7-16,29,37H,4-6,17-23H2,(H2,32,36);1H4/t29-;/m1./s1 |
| InChIKey | VKNIDVPHMFSVGL-XXIQNXCHSA-N |
| XLogP | 5.85 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.15 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|