C33H39ClN4O5 — CID 159310484
methane;methyl 5-[4-[carbamoyl(hydroxy)amino]but-1-ynyl]-2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]benzoate (PubChem CID 159310484) has the molecular formula C33H39ClN4O5 and a molecular weight of 607.15 g/mol. Its IUPAC name is methane;methyl 5-[4-[carbamoyl(hydroxy)amino]but-1-ynyl]-2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]benzoate.
| Compound Name | methane;methyl 5-[4-[carbamoyl(hydroxy)amino]but-1-ynyl]-2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]benzoate |
|---|---|
| PubChem CID | 159310484 |
| Molecular Formula | C33H39ClN4O5 |
| Molecular Weight | 607.15 g/mol |
| Exact Mass | 606.26 |
| IUPAC Name | methane;methyl 5-[4-[carbamoyl(hydroxy)amino]but-1-ynyl]-2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]benzoate |
| SMILES | C.COC(=O)c1cc(C#CCCN(O)C(N)=O)ccc1OCCN1CCN([C@H](c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C32H35ClN4O5.CH4/c1-41-31(38)28-23-24(7-5-6-16-37(40)32(34)39)10-15-29(28)42-22-21-35-17-19-36(20-18-35)30(25-8-3-2-4-9-25)26-11-13-27(33)14-12-26;/h2-4,8-15,23,30,40H,6,16-22H2,1H3,(H2,34,39);1H4/t30-;/m1./s1 |
| InChIKey | LCLYSNRZBGFKBV-VNUFCWELSA-N |
| XLogP | 5.06 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.15 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|