C31H32F2N4O5 — CID 23381071
2-[2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]ethoxy]-5-[4-[carbamoyl(hydroxy)amino]but-1-ynyl]benzoic acid (PubChem CID 23381071) has the molecular formula C31H32F2N4O5 and a molecular weight of 578.62 g/mol. Its IUPAC name is 2-[2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]ethoxy]-5-[4-[carbamoyl(hydroxy)amino]but-1-ynyl]benzoic acid.
| Compound Name | 2-[2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]ethoxy]-5-[4-[carbamoyl(hydroxy)amino]but-1-ynyl]benzoic acid |
|---|---|
| PubChem CID | 23381071 |
| Molecular Formula | C31H32F2N4O5 |
| Molecular Weight | 578.62 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | 2-[2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]ethoxy]-5-[4-[carbamoyl(hydroxy)amino]but-1-ynyl]benzoic acid |
| SMILES | NC(=O)N(O)CCC#Cc1ccc(OCCN2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)c(C(=O)O)c1 |
| InChI | InChI=1S/C31H32F2N4O5/c32-25-9-5-23(6-10-25)29(24-7-11-26(33)12-8-24)36-17-15-35(16-18-36)19-20-42-28-13-4-22(21-27(28)30(38)39)3-1-2-14-37(41)31(34)40/h4-13,21,29,41H,2,14-20H2,(H2,34,40)(H,38,39) |
| InChIKey | PLTCDIXXQOZZOE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.62 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|