C33H35ClN4O5 — CID 59910429
(E)-3-[5-[4-[carbamoyl(hydroxy)amino]but-1-ynyl]-2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]phenyl]prop-2-enoic acid (PubChem CID 59910429) has the molecular formula C33H35ClN4O5 and a molecular weight of 603.12 g/mol. Its IUPAC name is (E)-3-[5-[4-[carbamoyl(hydroxy)amino]but-1-ynyl]-2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[4-[carbamoyl(hydroxy)amino]but-1-ynyl]-2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 59910429 |
| Molecular Formula | C33H35ClN4O5 |
| Molecular Weight | 603.12 g/mol |
| Exact Mass | 602.23 |
| IUPAC Name | (E)-3-[5-[4-[carbamoyl(hydroxy)amino]but-1-ynyl]-2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]phenyl]prop-2-enoic acid |
| SMILES | NC(=O)N(O)CCC#Cc1ccc(OCCN2CCN([C@H](c3ccccc3)c3ccc(Cl)cc3)CC2)c(/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C33H35ClN4O5/c34-29-13-10-27(11-14-29)32(26-7-2-1-3-8-26)37-20-18-36(19-21-37)22-23-43-30-15-9-25(24-28(30)12-16-31(39)40)6-4-5-17-38(42)33(35)41/h1-3,7-16,24,32,42H,5,17-23H2,(H2,35,41)(H,39,40)/b16-12+/t32-/m1/s1 |
| InChIKey | VWFOTJWIEFFMJL-NDESMUNGSA-N |
| XLogP | 4.74 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.12 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|