C21H17ClO5 — CID 102596241
3,5-bis[4-(hydroxymethyl)phenoxy]benzoyl chloride (PubChem CID 102596241) has the molecular formula C21H17ClO5 and a molecular weight of 384.82 g/mol. Its IUPAC name is 3,5-bis[4-(hydroxymethyl)phenoxy]benzoyl chloride.
| Compound Name | 3,5-bis[4-(hydroxymethyl)phenoxy]benzoyl chloride |
|---|---|
| PubChem CID | 102596241 |
| Molecular Formula | C21H17ClO5 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 3,5-bis[4-(hydroxymethyl)phenoxy]benzoyl chloride |
| SMILES | O=C(Cl)c1cc(Oc2ccc(CO)cc2)cc(Oc2ccc(CO)cc2)c1 |
| InChI | InChI=1S/C21H17ClO5/c22-21(25)16-9-19(26-17-5-1-14(12-23)2-6-17)11-20(10-16)27-18-7-3-15(13-24)4-8-18/h1-11,23-24H,12-13H2 |
| InChIKey | GJBBWPRIKRDBJT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|