C17H14ClNO4 — CID 140972332
4-chloro-6-[4-(hydroxymethyl)phenoxy]-1-methylindole-2-carboxylic acid (PubChem CID 140972332) has the molecular formula C17H14ClNO4 and a molecular weight of 331.76 g/mol. Its IUPAC name is 4-chloro-6-[4-(hydroxymethyl)phenoxy]-1-methylindole-2-carboxylic acid.
| Compound Name | 4-chloro-6-[4-(hydroxymethyl)phenoxy]-1-methylindole-2-carboxylic acid |
|---|---|
| PubChem CID | 140972332 |
| Molecular Formula | C17H14ClNO4 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 4-chloro-6-[4-(hydroxymethyl)phenoxy]-1-methylindole-2-carboxylic acid |
| SMILES | Cn1c(C(=O)O)cc2c(Cl)cc(Oc3ccc(CO)cc3)cc21 |
| InChI | InChI=1S/C17H14ClNO4/c1-19-15-7-12(23-11-4-2-10(9-20)3-5-11)6-14(18)13(15)8-16(19)17(21)22/h2-8,20H,9H2,1H3,(H,21,22) |
| InChIKey | WDLYIQAMLCHJLO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |