C24H14Cl4O6 — CID 10816271
5-[[4-[(3,5-dicarbonochloridoylphenoxy)methyl]phenyl]methoxy]benzene-1,3-dicarbonyl chloride (PubChem CID 10816271) has the molecular formula C24H14Cl4O6 and a molecular weight of 540.18 g/mol. Its IUPAC name is 5-[[4-[(3,5-dicarbonochloridoylphenoxy)methyl]phenyl]methoxy]benzene-1,3-dicarbonyl chloride.
| Compound Name | 5-[[4-[(3,5-dicarbonochloridoylphenoxy)methyl]phenyl]methoxy]benzene-1,3-dicarbonyl chloride |
|---|---|
| PubChem CID | 10816271 |
| Molecular Formula | C24H14Cl4O6 |
| Molecular Weight | 540.18 g/mol |
| Exact Mass | 537.95 |
| IUPAC Name | 5-[[4-[(3,5-dicarbonochloridoylphenoxy)methyl]phenyl]methoxy]benzene-1,3-dicarbonyl chloride |
| SMILES | O=C(Cl)c1cc(OCc2ccc(COc3cc(C(=O)Cl)cc(C(=O)Cl)c3)cc2)cc(C(=O)Cl)c1 |
| InChI | InChI=1S/C24H14Cl4O6/c25-21(29)15-5-16(22(26)30)8-19(7-15)33-11-13-1-2-14(4-3-13)12-34-20-9-17(23(27)31)6-18(10-20)24(28)32/h1-10H,11-12H2 |
| InChIKey | LLPAROVBSCXVDI-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.18 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|