C21H29NO3 — CID 139435681
methyl 1-[[(3R)-6-butoxy-3-methyl-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxylate (PubChem CID 139435681) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is methyl 1-[[(3R)-6-butoxy-3-methyl-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxylate.
| Compound Name | methyl 1-[[(3R)-6-butoxy-3-methyl-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxylate |
|---|---|
| PubChem CID | 139435681 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | methyl 1-[[(3R)-6-butoxy-3-methyl-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxylate |
| SMILES | CCCCOc1ccc2c(c1)C[C@@H](C)C(CN1CC(C(=O)OC)C1)=C2 |
| InChI | InChI=1S/C21H29NO3/c1-4-5-8-25-20-7-6-16-10-18(15(2)9-17(16)11-20)12-22-13-19(14-22)21(23)24-3/h6-7,10-11,15,19H,4-5,8-9,12-14H2,1-3H3/t15-/m1/s1 |
| InChIKey | BRXGOIACSQRJIG-OAHLLOKOSA-N |
| XLogP | 3.55 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|