C21H29NO2 — CID 139434319
1-[[(3S)-3-methyl-6-pentyl-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxylic acid (PubChem CID 139434319) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is 1-[[(3S)-3-methyl-6-pentyl-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[[(3S)-3-methyl-6-pentyl-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 139434319 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 1-[[(3S)-3-methyl-6-pentyl-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxylic acid |
| SMILES | CCCCCc1ccc2c(c1)C[C@H](C)C(CN1CC(C(=O)O)C1)=C2 |
| InChI | InChI=1S/C21H29NO2/c1-3-4-5-6-16-7-8-17-11-19(15(2)9-18(17)10-16)12-22-13-20(14-22)21(23)24/h7-8,10-11,15,20H,3-6,9,12-14H2,1-2H3,(H,23,24)/t15-/m0/s1 |
| InChIKey | KXEVLMXUALYFEP-HNNXBMFYSA-N |
| XLogP | 4.01 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|