C22H29F3N2O3 — CID 170710327
N-(2-hydroxypropyl)-1-[[6-(4,4,4-trifluorobutoxy)-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxamide (PubChem CID 170710327) has the molecular formula C22H29F3N2O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-1-[[6-(4,4,4-trifluorobutoxy)-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxamide.
| Compound Name | N-(2-hydroxypropyl)-1-[[6-(4,4,4-trifluorobutoxy)-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 170710327 |
| Molecular Formula | C22H29F3N2O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | N-(2-hydroxypropyl)-1-[[6-(4,4,4-trifluorobutoxy)-3,4-dihydronaphthalen-2-yl]methyl]azetidine-3-carboxamide |
| SMILES | CC(O)CNC(=O)C1CN(CC2=Cc3ccc(OCCCC(F)(F)F)cc3CC2)C1 |
| InChI | InChI=1S/C22H29F3N2O3/c1-15(28)11-26-21(29)19-13-27(14-19)12-16-3-4-18-10-20(6-5-17(18)9-16)30-8-2-7-22(23,24)25/h5-6,9-10,15,19,28H,2-4,7-8,11-14H2,1H3,(H,26,29) |
| InChIKey | KFFBDYSBIJWCKH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|