C20H29F3N2O2 — CID 176930132
1-[[4-(3-methylbutoxy)phenyl]methyl]-N-(4,4,4-trifluorobutyl)azetidine-3-carboxamide (PubChem CID 176930132) has the molecular formula C20H29F3N2O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 1-[[4-(3-methylbutoxy)phenyl]methyl]-N-(4,4,4-trifluorobutyl)azetidine-3-carboxamide.
| Compound Name | 1-[[4-(3-methylbutoxy)phenyl]methyl]-N-(4,4,4-trifluorobutyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 176930132 |
| Molecular Formula | C20H29F3N2O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 1-[[4-(3-methylbutoxy)phenyl]methyl]-N-(4,4,4-trifluorobutyl)azetidine-3-carboxamide |
| SMILES | CC(C)CCOc1ccc(CN2CC(C(=O)NCCCC(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C20H29F3N2O2/c1-15(2)8-11-27-18-6-4-16(5-7-18)12-25-13-17(14-25)19(26)24-10-3-9-20(21,22)23/h4-7,15,17H,3,8-14H2,1-2H3,(H,24,26) |
| InChIKey | DJXBORPJADDZDU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|