C27H40ClO4P — CID 162170952
5-[3-chloro-4-[4-[(3,4-dimethylphenyl)methyl]heptoxy]phenyl]pentylphosphonic acid (PubChem CID 162170952) has the molecular formula C27H40ClO4P and a molecular weight of 495.04 g/mol. Its IUPAC name is 5-[3-chloro-4-[4-[(3,4-dimethylphenyl)methyl]heptoxy]phenyl]pentylphosphonic acid.
| Compound Name | 5-[3-chloro-4-[4-[(3,4-dimethylphenyl)methyl]heptoxy]phenyl]pentylphosphonic acid |
|---|---|
| PubChem CID | 162170952 |
| Molecular Formula | C27H40ClO4P |
| Molecular Weight | 495.04 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 5-[3-chloro-4-[4-[(3,4-dimethylphenyl)methyl]heptoxy]phenyl]pentylphosphonic acid |
| SMILES | CCCC(CCCOc1ccc(CCCCCP(=O)(O)O)cc1Cl)Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C27H40ClO4P/c1-4-9-23(19-25-13-12-21(2)22(3)18-25)11-8-16-32-27-15-14-24(20-26(27)28)10-6-5-7-17-33(29,30)31/h12-15,18,20,23H,4-11,16-17,19H2,1-3H3,(H2,29,30,31) |
| InChIKey | ZNTXHQVCBBHDMH-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.04 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|