C11H19NO4S — CID 23619205
1-(3,4-dimethylphenyl)propan-2-amine;sulfuric acid (PubChem CID 23619205) has the molecular formula C11H19NO4S and a molecular weight of 261.34 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)propan-2-amine;sulfuric acid.
| Compound Name | 1-(3,4-dimethylphenyl)propan-2-amine;sulfuric acid |
|---|---|
| PubChem CID | 23619205 |
| Molecular Formula | C11H19NO4S |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 1-(3,4-dimethylphenyl)propan-2-amine;sulfuric acid |
| SMILES | Cc1ccc(CC(C)N)cc1C.O=S(=O)(O)O |
| InChI | InChI=1S/C11H17N.H2O4S/c1-8-4-5-11(6-9(8)2)7-10(3)12;1-5(2,3)4/h4-6,10H,7,12H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | LJKHZLQTBIECLZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|