C13H21NO2S2 — CID 63835823
1-[3-methyl-4-(2-methylsulfonylethylsulfanyl)phenyl]propan-2-amine (PubChem CID 63835823) has the molecular formula C13H21NO2S2 and a molecular weight of 287.45 g/mol. Its IUPAC name is 1-[3-methyl-4-(2-methylsulfonylethylsulfanyl)phenyl]propan-2-amine.
| Compound Name | 1-[3-methyl-4-(2-methylsulfonylethylsulfanyl)phenyl]propan-2-amine |
|---|---|
| PubChem CID | 63835823 |
| Molecular Formula | C13H21NO2S2 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 1-[3-methyl-4-(2-methylsulfonylethylsulfanyl)phenyl]propan-2-amine |
| SMILES | Cc1cc(CC(C)N)ccc1SCCS(C)(=O)=O |
| InChI | InChI=1S/C13H21NO2S2/c1-10-8-12(9-11(2)14)4-5-13(10)17-6-7-18(3,15)16/h4-5,8,11H,6-7,9,14H2,1-3H3 |
| InChIKey | VCWQYGWMJYQEGJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |