C13H20ClNO2S2 — CID 81160678
N-[[3-chloro-4-(2-methylsulfonylethylsulfanyl)phenyl]methyl]propan-2-amine (PubChem CID 81160678) has the molecular formula C13H20ClNO2S2 and a molecular weight of 321.90 g/mol. Its IUPAC name is N-[[3-chloro-4-(2-methylsulfonylethylsulfanyl)phenyl]methyl]propan-2-amine.
| Compound Name | N-[[3-chloro-4-(2-methylsulfonylethylsulfanyl)phenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 81160678 |
| Molecular Formula | C13H20ClNO2S2 |
| Molecular Weight | 321.90 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | N-[[3-chloro-4-(2-methylsulfonylethylsulfanyl)phenyl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1ccc(SCCS(C)(=O)=O)c(Cl)c1 |
| InChI | InChI=1S/C13H20ClNO2S2/c1-10(2)15-9-11-4-5-13(12(14)8-11)18-6-7-19(3,16)17/h4-5,8,10,15H,6-7,9H2,1-3H3 |
| InChIKey | SVPFNZONEMYPMJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.90 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |