C30H44 — CID 142193611
4-[8-[1-(3,4-dimethylphenyl)ethenyl]-2-methylundecyl]-1,2-dimethylbenzene (PubChem CID 142193611) has the molecular formula C30H44 and a molecular weight of 404.68 g/mol. Its IUPAC name is 4-[8-[1-(3,4-dimethylphenyl)ethenyl]-2-methylundecyl]-1,2-dimethylbenzene.
| Compound Name | 4-[8-[1-(3,4-dimethylphenyl)ethenyl]-2-methylundecyl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 142193611 |
| Molecular Formula | C30H44 |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 404.34 |
| IUPAC Name | 4-[8-[1-(3,4-dimethylphenyl)ethenyl]-2-methylundecyl]-1,2-dimethylbenzene |
| SMILES | C=C(c1ccc(C)c(C)c1)C(CCC)CCCCCC(C)Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C30H44/c1-8-12-29(27(7)30-18-16-24(4)26(6)21-30)14-11-9-10-13-22(2)19-28-17-15-23(3)25(5)20-28/h15-18,20-22,29H,7-14,19H2,1-6H3 |
| InChIKey | XROGPIWBQSUDCT-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|