C28H40 — CID 142193578
1,2-dimethyl-4-[2-methyl-8-(1-phenylethenyl)undecyl]benzene (PubChem CID 142193578) has the molecular formula C28H40 and a molecular weight of 376.63 g/mol. Its IUPAC name is 1,2-dimethyl-4-[2-methyl-8-(1-phenylethenyl)undecyl]benzene.
| Compound Name | 1,2-dimethyl-4-[2-methyl-8-(1-phenylethenyl)undecyl]benzene |
|---|---|
| PubChem CID | 142193578 |
| Molecular Formula | C28H40 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.31 |
| IUPAC Name | 1,2-dimethyl-4-[2-methyl-8-(1-phenylethenyl)undecyl]benzene |
| SMILES | C=C(c1ccccc1)C(CCC)CCCCCC(C)Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C28H40/c1-6-13-27(25(5)28-16-11-8-12-17-28)15-10-7-9-14-22(2)20-26-19-18-23(3)24(4)21-26/h8,11-12,16-19,21-22,27H,5-7,9-10,13-15,20H2,1-4H3 |
| InChIKey | CKQRSGHWULAVPE-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|