C28H44 — CID 165127155
2-[(4Z)-3-methylidenehexa-1,4-dien-2-yl]-4-(2-methylundecyl)-1-propan-2-ylbenzene (PubChem CID 165127155) has the molecular formula C28H44 and a molecular weight of 380.66 g/mol. Its IUPAC name is 2-[(4Z)-3-methylidenehexa-1,4-dien-2-yl]-4-(2-methylundecyl)-1-propan-2-ylbenzene.
| Compound Name | 2-[(4Z)-3-methylidenehexa-1,4-dien-2-yl]-4-(2-methylundecyl)-1-propan-2-ylbenzene |
|---|---|
| PubChem CID | 165127155 |
| Molecular Formula | C28H44 |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 380.34 |
| IUPAC Name | 2-[(4Z)-3-methylidenehexa-1,4-dien-2-yl]-4-(2-methylundecyl)-1-propan-2-ylbenzene |
| SMILES | C=C(/C=C\C)C(=C)c1cc(CC(C)CCCCCCCCC)ccc1C(C)C |
| InChI | InChI=1S/C28H44/c1-8-10-11-12-13-14-15-17-23(5)20-26-18-19-27(22(3)4)28(21-26)25(7)24(6)16-9-2/h9,16,18-19,21-23H,6-8,10-15,17,20H2,1-5H3/b16-9- |
| InChIKey | LLAVETQQHZUHBR-SXGWCWSVSA-N |
| XLogP | 9.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|