C18H32O — CID 67682143
2-butan-2-yloxybutane;4-ethyl-1,2-dimethylbenzene (PubChem CID 67682143) has the molecular formula C18H32O and a molecular weight of 264.45 g/mol. Its IUPAC name is 2-butan-2-yloxybutane;4-ethyl-1,2-dimethylbenzene.
| Compound Name | 2-butan-2-yloxybutane;4-ethyl-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 67682143 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | 2-butan-2-yloxybutane;4-ethyl-1,2-dimethylbenzene |
| SMILES | CCC(C)OC(C)CC.CCc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C10H14.C8H18O/c1-4-10-6-5-8(2)9(3)7-10;1-5-7(3)9-8(4)6-2/h5-7H,4H2,1-3H3;7-8H,5-6H2,1-4H3 |
| InChIKey | UUIFYNDILQYXCU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |