C14H22O — CID 57274293
4-(1-butan-2-yloxyethyl)-1,2-dimethylbenzene (PubChem CID 57274293) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 4-(1-butan-2-yloxyethyl)-1,2-dimethylbenzene.
| Compound Name | 4-(1-butan-2-yloxyethyl)-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 57274293 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 4-(1-butan-2-yloxyethyl)-1,2-dimethylbenzene |
| SMILES | CCC(C)OC(C)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C14H22O/c1-6-12(4)15-13(5)14-8-7-10(2)11(3)9-14/h7-9,12-13H,6H2,1-5H3 |
| InChIKey | FHXRVJNZJFQDTD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |