C12H18O — CID 54163976
4-(1-methoxypropyl)-1,2-dimethylbenzene (PubChem CID 54163976) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is 4-(1-methoxypropyl)-1,2-dimethylbenzene.
| Compound Name | 4-(1-methoxypropyl)-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 54163976 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 4-(1-methoxypropyl)-1,2-dimethylbenzene |
| SMILES | CCC(OC)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C12H18O/c1-5-12(13-4)11-7-6-9(2)10(3)8-11/h6-8,12H,5H2,1-4H3 |
| InChIKey | OQJDRPYFZPBTEP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |