C10H14O3 — CID 134856299
2-(3,4-dimethylphenyl)-2-hydroperoxyethanol (PubChem CID 134856299) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-2-hydroperoxyethanol.
| Compound Name | 2-(3,4-dimethylphenyl)-2-hydroperoxyethanol |
|---|---|
| PubChem CID | 134856299 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-2-hydroperoxyethanol |
| SMILES | Cc1ccc(C(CO)OO)cc1C |
| InChI | InChI=1S/C10H14O3/c1-7-3-4-9(5-8(7)2)10(6-11)13-12/h3-5,10-12H,6H2,1-2H3 |
| InChIKey | YHMATOLGTOHNPH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|