C13H20O2 — CID 83927966
4-(3,4-dimethylphenyl)pentane-1,2-diol (PubChem CID 83927966) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)pentane-1,2-diol.
| Compound Name | 4-(3,4-dimethylphenyl)pentane-1,2-diol |
|---|---|
| PubChem CID | 83927966 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 4-(3,4-dimethylphenyl)pentane-1,2-diol |
| SMILES | Cc1ccc(C(C)CC(O)CO)cc1C |
| InChI | InChI=1S/C13H20O2/c1-9-4-5-12(6-10(9)2)11(3)7-13(15)8-14/h4-6,11,13-15H,7-8H2,1-3H3 |
| InChIKey | DNZFRXYNUONZGI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |