C16H26O2 — CID 83927974
2-(3,4-dimethylphenyl)octane-4,5-diol (PubChem CID 83927974) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)octane-4,5-diol.
| Compound Name | 2-(3,4-dimethylphenyl)octane-4,5-diol |
|---|---|
| PubChem CID | 83927974 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 2-(3,4-dimethylphenyl)octane-4,5-diol |
| SMILES | CCCC(O)C(O)CC(C)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H26O2/c1-5-6-15(17)16(18)10-13(4)14-8-7-11(2)12(3)9-14/h7-9,13,15-18H,5-6,10H2,1-4H3 |
| InChIKey | LWJJAAKLFQHFNA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |