C19H33NO — CID 83939263
5-amino-2-(3-tert-butyl-4-methylphenyl)octan-4-ol (PubChem CID 83939263) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is 5-amino-2-(3-tert-butyl-4-methylphenyl)octan-4-ol.
| Compound Name | 5-amino-2-(3-tert-butyl-4-methylphenyl)octan-4-ol |
|---|---|
| PubChem CID | 83939263 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | 5-amino-2-(3-tert-butyl-4-methylphenyl)octan-4-ol |
| SMILES | CCCC(N)C(O)CC(C)c1ccc(C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H33NO/c1-7-8-17(20)18(21)11-14(3)15-10-9-13(2)16(12-15)19(4,5)6/h9-10,12,14,17-18,21H,7-8,11,20H2,1-6H3 |
| InChIKey | HCWQUAXWWCQMLU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |