C17H29NO3S — CID 83927012
5-amino-2-(3-propan-2-ylsulfonylphenyl)octan-4-ol (PubChem CID 83927012) has the molecular formula C17H29NO3S and a molecular weight of 327.49 g/mol. Its IUPAC name is 5-amino-2-(3-propan-2-ylsulfonylphenyl)octan-4-ol.
| Compound Name | 5-amino-2-(3-propan-2-ylsulfonylphenyl)octan-4-ol |
|---|---|
| PubChem CID | 83927012 |
| Molecular Formula | C17H29NO3S |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 5-amino-2-(3-propan-2-ylsulfonylphenyl)octan-4-ol |
| SMILES | CCCC(N)C(O)CC(C)c1cccc(S(=O)(=O)C(C)C)c1 |
| InChI | InChI=1S/C17H29NO3S/c1-5-7-16(18)17(19)10-13(4)14-8-6-9-15(11-14)22(20,21)12(2)3/h6,8-9,11-13,16-17,19H,5,7,10,18H2,1-4H3 |
| InChIKey | AXMQVRZRUTYMQK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |