C14H24N2O3S — CID 83926933
4-amino-2-(methylamino)-1-(3-propan-2-ylsulfonylphenyl)butan-1-ol (PubChem CID 83926933) has the molecular formula C14H24N2O3S and a molecular weight of 300.42 g/mol. Its IUPAC name is 4-amino-2-(methylamino)-1-(3-propan-2-ylsulfonylphenyl)butan-1-ol.
| Compound Name | 4-amino-2-(methylamino)-1-(3-propan-2-ylsulfonylphenyl)butan-1-ol |
|---|---|
| PubChem CID | 83926933 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 4-amino-2-(methylamino)-1-(3-propan-2-ylsulfonylphenyl)butan-1-ol |
| SMILES | CNC(CCN)C(O)c1cccc(S(=O)(=O)C(C)C)c1 |
| InChI | InChI=1S/C14H24N2O3S/c1-10(2)20(18,19)12-6-4-5-11(9-12)14(17)13(16-3)7-8-15/h4-6,9-10,13-14,16-17H,7-8,15H2,1-3H3 |
| InChIKey | WTWALOCQOANLCO-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |