C13H22N2O3S — CID 83926432
2-amino-4-(dimethylamino)-1-(3-methylsulfonylphenyl)butan-1-ol (PubChem CID 83926432) has the molecular formula C13H22N2O3S and a molecular weight of 286.40 g/mol. Its IUPAC name is 2-amino-4-(dimethylamino)-1-(3-methylsulfonylphenyl)butan-1-ol.
| Compound Name | 2-amino-4-(dimethylamino)-1-(3-methylsulfonylphenyl)butan-1-ol |
|---|---|
| PubChem CID | 83926432 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-amino-4-(dimethylamino)-1-(3-methylsulfonylphenyl)butan-1-ol |
| SMILES | CN(C)CCC(N)C(O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C13H22N2O3S/c1-15(2)8-7-12(14)13(16)10-5-4-6-11(9-10)19(3,17)18/h4-6,9,12-13,16H,7-8,14H2,1-3H3 |
| InChIKey | KWINWDSOYXFJJB-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |