C13H21NO4S — CID 83926687
2-amino-1-(3-propylsulfonylphenyl)butane-1,4-diol (PubChem CID 83926687) has the molecular formula C13H21NO4S and a molecular weight of 287.38 g/mol. Its IUPAC name is 2-amino-1-(3-propylsulfonylphenyl)butane-1,4-diol.
| Compound Name | 2-amino-1-(3-propylsulfonylphenyl)butane-1,4-diol |
|---|---|
| PubChem CID | 83926687 |
| Molecular Formula | C13H21NO4S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2-amino-1-(3-propylsulfonylphenyl)butane-1,4-diol |
| SMILES | CCCS(=O)(=O)c1cccc(C(O)C(N)CCO)c1 |
| InChI | InChI=1S/C13H21NO4S/c1-2-8-19(17,18)11-5-3-4-10(9-11)13(16)12(14)6-7-15/h3-5,9,12-13,15-16H,2,6-8,14H2,1H3 |
| InChIKey | ZCORYAMIFQVERB-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |