C14H20O2S — CID 83926744
1-pent-4-en-2-yl-3-propylsulfonylbenzene (PubChem CID 83926744) has the molecular formula C14H20O2S and a molecular weight of 252.38 g/mol. Its IUPAC name is 1-pent-4-en-2-yl-3-propylsulfonylbenzene.
| Compound Name | 1-pent-4-en-2-yl-3-propylsulfonylbenzene |
|---|---|
| PubChem CID | 83926744 |
| Molecular Formula | C14H20O2S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 1-pent-4-en-2-yl-3-propylsulfonylbenzene |
| SMILES | C=CCC(C)c1cccc(S(=O)(=O)CCC)c1 |
| InChI | InChI=1S/C14H20O2S/c1-4-7-12(3)13-8-6-9-14(11-13)17(15,16)10-5-2/h4,6,8-9,11-12H,1,5,7,10H2,2-3H3 |
| InChIKey | SVNGZSCEEVNGJH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|