C15H22O2S — CID 83926747
1-[(Z)-hex-4-en-2-yl]-3-propylsulfonylbenzene (PubChem CID 83926747) has the molecular formula C15H22O2S and a molecular weight of 266.41 g/mol. Its IUPAC name is 1-[(Z)-hex-4-en-2-yl]-3-propylsulfonylbenzene.
| Compound Name | 1-[(Z)-hex-4-en-2-yl]-3-propylsulfonylbenzene |
|---|---|
| PubChem CID | 83926747 |
| Molecular Formula | C15H22O2S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 1-[(Z)-hex-4-en-2-yl]-3-propylsulfonylbenzene |
| SMILES | C/C=C\CC(C)c1cccc(S(=O)(=O)CCC)c1 |
| InChI | InChI=1S/C15H22O2S/c1-4-6-8-13(3)14-9-7-10-15(12-14)18(16,17)11-5-2/h4,6-7,9-10,12-13H,5,8,11H2,1-3H3/b6-4- |
| InChIKey | RFIUSFBJMDKKMA-XQRVVYSFSA-N |
| XLogP | 3.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|