C19H32O3 — CID 83936816
2-(3-tert-butyl-4-methoxyphenyl)octane-4,5-diol (PubChem CID 83936816) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is 2-(3-tert-butyl-4-methoxyphenyl)octane-4,5-diol.
| Compound Name | 2-(3-tert-butyl-4-methoxyphenyl)octane-4,5-diol |
|---|---|
| PubChem CID | 83936816 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 2-(3-tert-butyl-4-methoxyphenyl)octane-4,5-diol |
| SMILES | CCCC(O)C(O)CC(C)c1ccc(OC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H32O3/c1-7-8-16(20)17(21)11-13(2)14-9-10-18(22-6)15(12-14)19(3,4)5/h9-10,12-13,16-17,20-21H,7-8,11H2,1-6H3 |
| InChIKey | KOOQNEACWDCHCO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |