C12H17ClO2 — CID 83937440
4-(4-chloro-3-methylphenyl)pentane-1,2-diol (PubChem CID 83937440) has the molecular formula C12H17ClO2 and a molecular weight of 228.72 g/mol. Its IUPAC name is 4-(4-chloro-3-methylphenyl)pentane-1,2-diol.
| Compound Name | 4-(4-chloro-3-methylphenyl)pentane-1,2-diol |
|---|---|
| PubChem CID | 83937440 |
| Molecular Formula | C12H17ClO2 |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 4-(4-chloro-3-methylphenyl)pentane-1,2-diol |
| SMILES | Cc1cc(C(C)CC(O)CO)ccc1Cl |
| InChI | InChI=1S/C12H17ClO2/c1-8(6-11(15)7-14)10-3-4-12(13)9(2)5-10/h3-5,8,11,14-15H,6-7H2,1-2H3 |
| InChIKey | AGZUPMYRDBYKMI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |